C30H35N3O4 — CID 129310455
benzyl N-[1-[2-(2-methylphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 129310455) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is benzyl N-[1-[2-(2-methylphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[1-[2-(2-methylphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 129310455 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | benzyl N-[1-[2-(2-methylphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | Cc1ccccc1CCN1CCCC(N(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C30H35N3O4/c1-24-11-8-9-16-27(24)18-20-32-19-10-17-28(21-32)33(30(35)37-23-26-14-6-3-7-15-26)31-29(34)36-22-25-12-4-2-5-13-25/h2-9,11-16,28H,10,17-23H2,1H3,(H,31,34) |
| InChIKey | AAWURIKNOIGZSB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|