C35H37N3O5 — CID 129310465
benzyl N-[1-[2-(2-phenoxyphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 129310465) has the molecular formula C35H37N3O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is benzyl N-[1-[2-(2-phenoxyphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[1-[2-(2-phenoxyphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 129310465 |
| Molecular Formula | C35H37N3O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | benzyl N-[1-[2-(2-phenoxyphenyl)ethyl]piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)C1CCCN(CCc2ccccc2Oc2ccccc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C35H37N3O5/c39-34(41-26-28-13-4-1-5-14-28)36-38(35(40)42-27-29-15-6-2-7-16-29)31-18-12-23-37(25-31)24-22-30-17-10-11-21-33(30)43-32-19-8-3-9-20-32/h1-11,13-17,19-21,31H,12,18,22-27H2,(H,36,39) |
| InChIKey | IMINZFCMNHPYNI-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|