C13H18N2O3 — CID 117012141
[4-amino-1-(1,3-benzodioxol-5-yl)piperidin-4-yl]methanol (PubChem CID 117012141) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is [4-amino-1-(1,3-benzodioxol-5-yl)piperidin-4-yl]methanol.
| Compound Name | [4-amino-1-(1,3-benzodioxol-5-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 117012141 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [4-amino-1-(1,3-benzodioxol-5-yl)piperidin-4-yl]methanol |
| SMILES | NC1(CO)CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C13H18N2O3/c14-13(8-16)3-5-15(6-4-13)10-1-2-11-12(7-10)18-9-17-11/h1-2,7,16H,3-6,8-9,14H2 |
| InChIKey | XAFBYKOZINJRPW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|