C13H15N3O2 — CID 117013108
4-amino-1-(1,3-benzodioxol-5-yl)piperidine-4-carbonitrile (PubChem CID 117013108) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-amino-1-(1,3-benzodioxol-5-yl)piperidine-4-carbonitrile.
| Compound Name | 4-amino-1-(1,3-benzodioxol-5-yl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 117013108 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-amino-1-(1,3-benzodioxol-5-yl)piperidine-4-carbonitrile |
| SMILES | N#CC1(N)CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C13H15N3O2/c14-8-13(15)3-5-16(6-4-13)10-1-2-11-12(7-10)18-9-17-11/h1-2,7H,3-6,9,15H2 |
| InChIKey | LBZYWWPSSYADTR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|