About [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol
[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol (PubChem CID 117019827) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol |
| PubChem CID | 117019827 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol |
| SMILES | CC1(C)C(CO)CCCN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)11(9-17)4-3-7-16(15)12-5-6-13-14(8-12)19-10-18-13/h5-6,8,11,17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | SQCUOEGVJFLISM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol?
The IUPAC name of [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol (CID 117019827) is [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol.
What is the SMILES notation for [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol?
The canonical SMILES for [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol is CC1(C)C(CO)CCCN1c1ccc2c(c1)OCO2.
What is the InChIKey of [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol?
The InChIKey is SQCUOEGVJFLISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-15(2)11(9-17)4-3-7-16(15)12-5-6-13-14(8-12)19-10-18-13/h5-6,8,11,17H,3-4,7,9-10H2,1-2H3.
What are the key properties of [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol?
[1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol has a molecular weight of 263.34 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-benzodioxol-5-yl)-2,2-dimethylpiperidin-3-yl]methanol is sourced from PubChem (CID 117019827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).