C15H22N2O2 — CID 117019255
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpiperidin-3-amine (PubChem CID 117019255) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpiperidin-3-amine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 117019255 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpiperidin-3-amine |
| SMILES | CC1(C)C(N)CCCN1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2)14(16)4-3-7-17(15)11-5-6-12-13(10-11)19-9-8-18-12/h5-6,10,14H,3-4,7-9,16H2,1-2H3 |
| InChIKey | DSSOBCSZZCWSBU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|