C16H14N4O3 — CID 11335875
(3S,4R)-4-(4-azidophenyl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 11335875) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is (3S,4R)-4-(4-azidophenyl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-4-(4-azidophenyl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11335875 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3S,4R)-4-(4-azidophenyl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](O)[C@H]2c2ccc(N=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C16H14N4O3/c1-23-13-8-6-12(7-9-13)20-14(15(21)16(20)22)10-2-4-11(5-3-10)18-19-17/h2-9,14-15,21H,1H3/t14-,15+/m1/s1 |
| InChIKey | QFANBCWIBNEPSI-CABCVRRESA-N |
| XLogP | 3.09 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|