C24H23NO5 — CID 135013406
4-(3,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3-phenoxyazetidin-2-one (PubChem CID 135013406) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3-phenoxyazetidin-2-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 135013406 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3-phenoxyazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(Oc3ccccc3)C2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H23NO5/c1-27-18-12-10-17(11-13-18)25-22(16-9-14-20(28-2)21(15-16)29-3)23(24(25)26)30-19-7-5-4-6-8-19/h4-15,22-23H,1-3H3 |
| InChIKey | ARHNDSOMNPOZHU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |