C22H18N2O5 — CID 11523958
(3S,4R)-1-(4-methoxyphenyl)-4-(2-nitrophenyl)-3-phenoxyazetidin-2-one (PubChem CID 11523958) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is (3S,4R)-1-(4-methoxyphenyl)-4-(2-nitrophenyl)-3-phenoxyazetidin-2-one.
| Compound Name | (3S,4R)-1-(4-methoxyphenyl)-4-(2-nitrophenyl)-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 11523958 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (3S,4R)-1-(4-methoxyphenyl)-4-(2-nitrophenyl)-3-phenoxyazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](Oc3ccccc3)[C@H]2c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N2O5/c1-28-16-13-11-15(12-14-16)23-20(18-9-5-6-10-19(18)24(26)27)21(22(23)25)29-17-7-3-2-4-8-17/h2-14,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | BYOCWQRQXVLHCP-RTWAWAEBSA-N |
| XLogP | 4.14 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|