C22H17NO5 — CID 54498829
4-[(2S,3R)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]benzoic acid (PubChem CID 54498829) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-[(2S,3R)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]benzoic acid.
| Compound Name | 4-[(2S,3R)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 54498829 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-[(2S,3R)-2-(2-hydroxyphenyl)-4-oxo-3-phenoxyazetidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)[C@H](Oc3ccccc3)[C@@H]2c2ccccc2O)cc1 |
| InChI | InChI=1S/C22H17NO5/c24-18-9-5-4-8-17(18)19-20(28-16-6-2-1-3-7-16)21(25)23(19)15-12-10-14(11-13-15)22(26)27/h1-13,19-20,24H,(H,26,27)/t19-,20+/m0/s1 |
| InChIKey | YAZXEIGPPQJMFW-VQTJNVASSA-N |
| XLogP | 3.63 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|