C24H23NO7 — CID 127025179
(3S,4R)-4-(3,4-dihydroxyphenyl)-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 127025179) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is (3S,4R)-4-(3,4-dihydroxyphenyl)-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-4-(3,4-dihydroxyphenyl)-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 127025179 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (3S,4R)-4-(3,4-dihydroxyphenyl)-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | COc1cc(N2C(=O)[C@@H](Oc3ccccc3)[C@H]2c2ccc(O)c(O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO7/c1-29-19-12-15(13-20(30-2)22(19)31-3)25-21(14-9-10-17(26)18(27)11-14)23(24(25)28)32-16-7-5-4-6-8-16/h4-13,21,23,26-27H,1-3H3/t21-,23+/m1/s1 |
| InChIKey | CABPEUCXPMAGSG-GGAORHGYSA-N |
| XLogP | 3.66 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|