C25H26NO10P — CID 127025535
[2-methoxy-5-[(2R,3S)-4-oxo-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] dihydrogen phosphate (PubChem CID 127025535) has the molecular formula C25H26NO10P and a molecular weight of 531.45 g/mol. Its IUPAC name is [2-methoxy-5-[(2R,3S)-4-oxo-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[(2R,3S)-4-oxo-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 127025535 |
| Molecular Formula | C25H26NO10P |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | [2-methoxy-5-[(2R,3S)-4-oxo-3-phenoxy-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc([C@@H]2[C@H](Oc3ccccc3)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C25H26NO10P/c1-31-18-11-10-15(12-19(18)36-37(28,29)30)22-24(35-17-8-6-5-7-9-17)25(27)26(22)16-13-20(32-2)23(34-4)21(14-16)33-3/h5-14,22,24H,1-4H3,(H2,28,29,30)/t22-,24+/m1/s1 |
| InChIKey | JTKRTJVNISFCEW-VWNXMTODSA-N |
| XLogP | 3.73 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|