C29H30N2O5 — CID 23250645
(2R,5S,6R)-2-[(2S,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one (PubChem CID 23250645) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is (2R,5S,6R)-2-[(2S,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one.
| Compound Name | (2R,5S,6R)-2-[(2S,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 23250645 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (2R,5S,6R)-2-[(2S,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one |
| SMILES | COc1ccc([C@H]2[C@@H](O[C@@]3(C)O[C@H](c4ccccc4)[C@H](C)N(C)C3=O)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O5/c1-19-25(21-11-7-5-8-12-21)35-29(2,28(33)30(19)3)36-26-24(20-15-17-23(34-4)18-16-20)31(27(26)32)22-13-9-6-10-14-22/h5-19,24-26H,1-4H3/t19-,24-,25-,26+,29+/m0/s1 |
| InChIKey | XFEIHNAKKAOOLN-CXJAPECMSA-N |
| XLogP | 4.50 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |