C28H25F3NO4PS — CID 139037499
1-(4-methoxyphenyl)-4,4-diphenyl-2,3-dihydro-1,4-benzazaphosphinin-4-ium;trifluoromethanesulfonate (PubChem CID 139037499) has the molecular formula C28H25F3NO4PS and a molecular weight of 559.55 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4,4-diphenyl-2,3-dihydro-1,4-benzazaphosphinin-4-ium;trifluoromethanesulfonate.
| Compound Name | 1-(4-methoxyphenyl)-4,4-diphenyl-2,3-dihydro-1,4-benzazaphosphinin-4-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139037499 |
| Molecular Formula | C28H25F3NO4PS |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-4,4-diphenyl-2,3-dihydro-1,4-benzazaphosphinin-4-ium;trifluoromethanesulfonate |
| SMILES | COc1ccc(N2CC[P+](c3ccccc3)(c3ccccc3)c3ccccc32)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H25NOP.CHF3O3S/c1-29-23-18-16-22(17-19-23)28-20-21-30(24-10-4-2-5-11-24,25-12-6-3-7-13-25)27-15-9-8-14-26(27)28;2-1(3,4)8(5,6)7/h2-19H,20-21H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JYXXDOXNUULTPH-UHFFFAOYSA-M |
| XLogP | 5.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|