C19H21F3N2O3S — CID 55829603
1-(4-methoxyphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]-1,4-diazepane (PubChem CID 55829603) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]-1,4-diazepane.
| Compound Name | 1-(4-methoxyphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 55829603 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]-1,4-diazepane |
| SMILES | COc1ccc(N2CCCN(c3ccccc3S(=O)(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H21F3N2O3S/c1-27-16-9-7-15(8-10-16)23-11-4-12-24(14-13-23)17-5-2-3-6-18(17)28(25,26)19(20,21)22/h2-3,5-10H,4,11-14H2,1H3 |
| InChIKey | SVQKCBUYZSNUBB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|