C19H23N2O+ — CID 10527255
[(3S,4S)-1-(4-methoxyphenyl)-3-methyl-4-phenylazetidin-2-ylidene]-dimethylazanium (PubChem CID 10527255) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is [(3S,4S)-1-(4-methoxyphenyl)-3-methyl-4-phenylazetidin-2-ylidene]-dimethylazanium.
| Compound Name | [(3S,4S)-1-(4-methoxyphenyl)-3-methyl-4-phenylazetidin-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 10527255 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [(3S,4S)-1-(4-methoxyphenyl)-3-methyl-4-phenylazetidin-2-ylidene]-dimethylazanium |
| SMILES | COc1ccc(N2C(=[N+](C)C)[C@@H](C)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N2O/c1-14-18(15-8-6-5-7-9-15)21(19(14)20(2)3)16-10-12-17(22-4)13-11-16/h5-14,18H,1-4H3/q+1/t14-,18-/m0/s1 |
| InChIKey | UVYVTUVDUDHBNO-KSSFIOAISA-N |
| XLogP | 3.56 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|