C26H22FeN2O4 — CID 134919408
CID 134919408 (PubChem CID 134919408) has the molecular formula C26H22FeN2O4 and a molecular weight of 482.32 g/mol.
| Compound Name | CID 134919408 |
|---|---|
| PubChem CID | 134919408 |
| Molecular Formula | C26H22FeN2O4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | — |
| SMILES | COc1ccc(N2C(=O)[C@H]([C]3[CH][CH][CH][CH]3)[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C21H17N2O4.C5H5.Fe/c1-27-18-12-10-16(11-13-18)22-20(15-6-8-17(9-7-15)23(25)26)19(21(22)24)14-4-2-3-5-14;1-2-4-5-3-1;/h2-13,19-20H,1H3;1-5H;/t19-,20+;;/m1../s1 |
| InChIKey | JEBDVVIBONUUMM-AAYDIPMQSA-N |
| XLogP | 4.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|