C21H20N4O5 — CID 7276594
(2S,6S,7S)-7-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 7276594) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is (2S,6S,7S)-7-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (2S,6S,7S)-7-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 7276594 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2S,6S,7S)-7-(4-methoxyphenyl)-4-(4-nitrophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | COc1ccc([C@@H]2[C@@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@H]3N3CCCN23)cc1 |
| InChI | InChI=1S/C21H20N4O5/c1-30-16-9-3-13(4-10-16)18-17-19(23-12-2-11-22(18)23)21(27)24(20(17)26)14-5-7-15(8-6-14)25(28)29/h3-10,17-19H,2,11-12H2,1H3/t17-,18+,19-/m0/s1 |
| InChIKey | HNHULONBMOKPMS-OTWHNJEPSA-N |
| XLogP | 2.14 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|