C12H10N2O3S — CID 14587143
2-[2-oxo-4-(sulfanylmethyl)azetidin-3-yl]isoindole-1,3-dione (PubChem CID 14587143) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-[2-oxo-4-(sulfanylmethyl)azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-4-(sulfanylmethyl)azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14587143 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-[2-oxo-4-(sulfanylmethyl)azetidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(CS)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10N2O3S/c15-10-9(8(5-18)13-10)14-11(16)6-3-1-2-4-7(6)12(14)17/h1-4,8-9,18H,5H2,(H,13,15) |
| InChIKey | UEICXOIMCJUJJX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|