C12H9IN2O3 — CID 13424464
2-[2-(iodomethyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 13424464) has the molecular formula C12H9IN2O3 and a molecular weight of 356.12 g/mol. Its IUPAC name is 2-[2-(iodomethyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(iodomethyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13424464 |
| Molecular Formula | C12H9IN2O3 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2-[2-(iodomethyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(CI)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H9IN2O3/c13-5-8-9(10(16)14-8)15-11(17)6-3-1-2-4-7(6)12(15)18/h1-4,8-9H,5H2,(H,14,16) |
| InChIKey | XEGAQVCAIFDMBL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|