C13H9N3O3S — CID 86743759
[(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl]methyl thiocyanate (PubChem CID 86743759) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is [(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl]methyl thiocyanate.
| Compound Name | [(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 86743759 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl]methyl thiocyanate |
| SMILES | N#CSC[C@H]1NC(=O)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H9N3O3S/c14-6-20-5-9-10(11(17)15-9)16-12(18)7-3-1-2-4-8(7)13(16)19/h1-4,9-10H,5H2,(H,15,17)/t9-,10+/m1/s1 |
| InChIKey | UKIJXJTVWCNRDZ-ZJUUUORDSA-N |
| XLogP | 0.36 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|