C5H7N3OS — CID 86743761
[(2S,3S)-3-amino-4-oxoazetidin-2-yl]methyl thiocyanate (PubChem CID 86743761) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is [(2S,3S)-3-amino-4-oxoazetidin-2-yl]methyl thiocyanate.
| Compound Name | [(2S,3S)-3-amino-4-oxoazetidin-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 86743761 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | [(2S,3S)-3-amino-4-oxoazetidin-2-yl]methyl thiocyanate |
| SMILES | N#CSC[C@H]1NC(=O)[C@H]1N |
| InChI | InChI=1S/C5H7N3OS/c6-2-10-1-3-4(7)5(9)8-3/h3-4H,1,7H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | CLLYQCYOUQBEKT-DMTCNVIQSA-N |
| XLogP | -0.97 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|