C6H11NO5 — CID 172642030
(4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-one (PubChem CID 172642030) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-one.
| Compound Name | (4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-one |
|---|---|
| PubChem CID | 172642030 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-one |
| SMILES | O=C1NC(CO)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C6H11NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-5,8-11H,1H2,(H,7,12)/t2?,3-,4-,5?/m1/s1 |
| InChIKey | AJJXPYDGVXIEHE-UUUZDELHSA-N |
| XLogP | -3.44 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |