C10H22N3O4+ — CID 135797423
4-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-ylidene]amino]butylazanium (PubChem CID 135797423) has the molecular formula C10H22N3O4+ and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-ylidene]amino]butylazanium.
| Compound Name | 4-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-ylidene]amino]butylazanium |
|---|---|
| PubChem CID | 135797423 |
| Molecular Formula | C10H22N3O4+ |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)piperidin-2-ylidene]amino]butylazanium |
| SMILES | [NH3+]CCCC/N=C1\N[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21N3O4/c11-3-1-2-4-12-10-9(17)8(16)7(15)6(5-14)13-10/h6-9,14-17H,1-5,11H2,(H,12,13)/p+1/t6-,7-,8+,9+/m1/s1 |
| InChIKey | ZLLQXILWWIGNJJ-HXFLIBJXSA-O |
| XLogP | -3.55 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|