C14H20N2O4 — CID 137007065
(2R,3S,4S,5S)-2-(hydroxymethyl)-6-(2-phenylethylimino)piperidine-3,4,5-triol (PubChem CID 137007065) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(hydroxymethyl)-6-(2-phenylethylimino)piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-6-(2-phenylethylimino)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 137007065 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-6-(2-phenylethylimino)piperidine-3,4,5-triol |
| SMILES | OC[C@H]1N/C(=N\CCc2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N2O4/c17-8-10-11(18)12(19)13(20)14(16-10)15-7-6-9-4-2-1-3-5-9/h1-5,10-13,17-20H,6-8H2,(H,15,16)/t10-,11+,12+,13-/m1/s1 |
| InChIKey | AHZGXCNCDNASLZ-MROQNXINSA-N |
| XLogP | -1.33 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|