C12H17N3O4 — CID 75094325
6-(hydroxymethyl)-2-(phenylmethoxyamino)-1,4,5,6-tetrahydropyrimidine-4,5-diol (PubChem CID 75094325) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-(phenylmethoxyamino)-1,4,5,6-tetrahydropyrimidine-4,5-diol.
| Compound Name | 6-(hydroxymethyl)-2-(phenylmethoxyamino)-1,4,5,6-tetrahydropyrimidine-4,5-diol |
|---|---|
| PubChem CID | 75094325 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-(hydroxymethyl)-2-(phenylmethoxyamino)-1,4,5,6-tetrahydropyrimidine-4,5-diol |
| SMILES | OCC1NC(NOCc2ccccc2)=NC(O)C1O |
| InChI | InChI=1S/C12H17N3O4/c16-6-9-10(17)11(18)14-12(13-9)15-19-7-8-4-2-1-3-5-8/h1-5,9-11,16-18H,6-7H2,(H2,13,14,15) |
| InChIKey | YPFOZBKMDYRTLE-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|