C7H13NO2 — CID 129405542
(3R,4R,5S)-5-(hydroxymethyl)-3,4-dimethylpyrrolidin-2-one (PubChem CID 129405542) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3R,4R,5S)-5-(hydroxymethyl)-3,4-dimethylpyrrolidin-2-one.
| Compound Name | (3R,4R,5S)-5-(hydroxymethyl)-3,4-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 129405542 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3R,4R,5S)-5-(hydroxymethyl)-3,4-dimethylpyrrolidin-2-one |
| SMILES | C[C@H]1[C@@H](CO)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C7H13NO2/c1-4-5(2)7(10)8-6(4)3-9/h4-6,9H,3H2,1-2H3,(H,8,10)/t4-,5-,6-/m1/s1 |
| InChIKey | XZYAFCNNSYIEHZ-HSUXUTPPSA-N |
| XLogP | -0.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |