About (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one
(4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 58605421) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 58605421 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC1(C)C2C(=O)N[C@H](CO)[C@H]21 |
| InChI | InChI=1S/C8H13NO2/c1-8(2)5-4(3-10)9-7(11)6(5)8/h4-6,10H,3H2,1-2H3,(H,9,11)/t4-,5-,6?/m1/s1 |
| InChIKey | PUONKOIYAUJADZ-QYRBDRAASA-N |
| XLogP | -0.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one?
The IUPAC name of (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one (CID 58605421) is (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one is CC1(C)C2C(=O)N[C@H](CO)[C@H]21.
What is the InChIKey of (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one?
The InChIKey is PUONKOIYAUJADZ-QYRBDRAASA-N. The full InChI is InChI=1S/C8H13NO2/c1-8(2)5-4(3-10)9-7(11)6(5)8/h4-6,10H,3H2,1-2H3,(H,9,11)/t4-,5-,6?/m1/s1.
What are the key properties of (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one?
(4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one has a molecular weight of 155.20 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4-(hydroxymethyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 58605421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).