C7H9F2NO2 — CID 123504194
6-(difluoromethyl)-4-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 123504194) has the molecular formula C7H9F2NO2 and a molecular weight of 177.15 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 6-(difluoromethyl)-4-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 123504194 |
| Molecular Formula | C7H9F2NO2 |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 6-(difluoromethyl)-4-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1NC(CO)C2C1C2C(F)F |
| InChI | InChI=1S/C7H9F2NO2/c8-6(9)4-3-2(1-11)10-7(12)5(3)4/h2-6,11H,1H2,(H,10,12) |
| InChIKey | NVKUUUHXLXMMOV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |