C5H9NO5 — CID 130149480
5-(dihydroxymethyl)-4-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 130149480) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is 5-(dihydroxymethyl)-4-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(dihydroxymethyl)-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130149480 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 5-(dihydroxymethyl)-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CO)C(C(O)O)O1 |
| InChI | InChI=1S/C5H9NO5/c7-1-2-3(4(8)9)11-5(10)6-2/h2-4,7-9H,1H2,(H,6,10) |
| InChIKey | RMTWMBOVRQUXGA-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|