C5H9NO5 — CID 151073859
5-(dihydroxymethyl)-3,4-dihydroxypyrrolidin-2-one (PubChem CID 151073859) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is 5-(dihydroxymethyl)-3,4-dihydroxypyrrolidin-2-one.
| Compound Name | 5-(dihydroxymethyl)-3,4-dihydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 151073859 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 5-(dihydroxymethyl)-3,4-dihydroxypyrrolidin-2-one |
| SMILES | O=C1NC(C(O)O)C(O)C1O |
| InChI | InChI=1S/C5H9NO5/c7-2-1(5(10)11)6-4(9)3(2)8/h1-3,5,7-8,10-11H,(H,6,9) |
| InChIKey | MIRQLPXAUWVXRS-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|