C32H28N2O4 — CID 174346839
2-[(4R,8S)-8-(hydroxymethyl)-7-naphthalen-2-yl-2-oxo-4-phenylazocan-3-yl]isoindole-1,3-dione (PubChem CID 174346839) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[(4R,8S)-8-(hydroxymethyl)-7-naphthalen-2-yl-2-oxo-4-phenylazocan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(4R,8S)-8-(hydroxymethyl)-7-naphthalen-2-yl-2-oxo-4-phenylazocan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 174346839 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 2-[(4R,8S)-8-(hydroxymethyl)-7-naphthalen-2-yl-2-oxo-4-phenylazocan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1N[C@H](CO)C(c2ccc3ccccc3c2)CC[C@H](c2ccccc2)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H28N2O4/c35-19-28-24(23-15-14-20-8-4-5-11-22(20)18-23)16-17-25(21-9-2-1-3-10-21)29(30(36)33-28)34-31(37)26-12-6-7-13-27(26)32(34)38/h1-15,18,24-25,28-29,35H,16-17,19H2,(H,33,36)/t24?,25-,28-,29?/m1/s1 |
| InChIKey | HYRWWMHFULWFIC-HUQDUFEYSA-N |
| XLogP | 4.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|