C19H21N4O5+ — CID 7405463
(NE)-N-[(2R,3S,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7405463) has the molecular formula C19H21N4O5+ and a molecular weight of 385.40 g/mol. Its IUPAC name is (NE)-N-[(2R,3S,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,3S,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7405463 |
| Molecular Formula | C19H21N4O5+ |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (NE)-N-[(2R,3S,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | CC[C@@H]1/C(=N/O)C[C@@H](c2ccc([N+](=O)[O-])cc2)[NH2+]C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-2-16-18(21-24)11-17(12-3-7-14(8-4-12)22(25)26)20-19(16)13-5-9-15(10-6-13)23(27)28/h3-10,16-17,19-20,24H,2,11H2,1H3/p+1/b21-18+/t16-,17+,19?/m1/s1 |
| InChIKey | XHWQPGMAHKBRBX-WNWCELTISA-O |
| XLogP | 3.11 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|