C20H29N3O3+2 — CID 7112397
2-(4-nitrophenyl)-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7112397) has the molecular formula C20H29N3O3+2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-(4-nitrophenyl)-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7112397 |
| Molecular Formula | C20H29N3O3+2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-(4-nitrophenyl)-5,7-dipropyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCCC12C[NH+]3CC(CCC)(C[NH+](C1)C3c1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C20H27N3O3/c1-3-9-19-11-21-13-20(10-4-2,18(19)24)14-22(12-19)17(21)15-5-7-16(8-6-15)23(25)26/h5-8,17H,3-4,9-14H2,1-2H3/p+2 |
| InChIKey | YUVGLWABFWSIQN-UHFFFAOYSA-P |
| XLogP | 0.55 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|