C18H25N3O3+2 — CID 7335420
5-methyl-2-(2-nitrophenyl)-7-propyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7335420) has the molecular formula C18H25N3O3+2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-methyl-2-(2-nitrophenyl)-7-propyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5-methyl-2-(2-nitrophenyl)-7-propyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7335420 |
| Molecular Formula | C18H25N3O3+2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-methyl-2-(2-nitrophenyl)-7-propyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCCC12C[NH+]3CC(C)(C[NH+](C1)C3c1ccccc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C18H23N3O3/c1-3-8-18-11-19-9-17(2,16(18)22)10-20(12-18)15(19)13-6-4-5-7-14(13)21(23)24/h4-7,15H,3,8-12H2,1-2H3/p+2 |
| InChIKey | GNRHNUFAKZKWDP-UHFFFAOYSA-P |
| XLogP | -0.23 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|