C15H21NO4 — CID 66343737
2,2-diethyl-3-(2-methyl-5-nitrophenoxy)cyclobutan-1-ol (PubChem CID 66343737) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2,2-diethyl-3-(2-methyl-5-nitrophenoxy)cyclobutan-1-ol.
| Compound Name | 2,2-diethyl-3-(2-methyl-5-nitrophenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 66343737 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2,2-diethyl-3-(2-methyl-5-nitrophenoxy)cyclobutan-1-ol |
| SMILES | CCC1(CC)C(O)CC1Oc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C15H21NO4/c1-4-15(5-2)13(17)9-14(15)20-12-8-11(16(18)19)7-6-10(12)3/h6-8,13-14,17H,4-5,9H2,1-3H3 |
| InChIKey | SHGYEVRXYNHUHE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|