C13H18FNO3 — CID 118242697
N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine (PubChem CID 118242697) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine.
| Compound Name | N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine |
|---|---|
| PubChem CID | 118242697 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine |
| SMILES | CO[C@H]1CCCC[C@@H]1Oc1cc(F)ccc1NO |
| InChI | InChI=1S/C13H18FNO3/c1-17-11-4-2-3-5-12(11)18-13-8-9(14)6-7-10(13)15-16/h6-8,11-12,15-16H,2-5H2,1H3/t11-,12-/m0/s1 |
| InChIKey | QMWDDKCJNJYMGD-RYUDHWBXSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|