About N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine
N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine (PubChem CID 118242697) has the molecular formula C13H18FNO3
and a molecular weight of 255.29 g/mol. Its IUPAC name is N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine |
| PubChem CID | 118242697 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine |
| SMILES | CO[C@H]1CCCC[C@@H]1Oc1cc(F)ccc1NO |
| InChI | InChI=1S/C13H18FNO3/c1-17-11-4-2-3-5-12(11)18-13-8-9(14)6-7-10(13)15-16/h6-8,11-12,15-16H,2-5H2,1H3/t11-,12-/m0/s1 |
| InChIKey | QMWDDKCJNJYMGD-RYUDHWBXSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine?
The IUPAC name of N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine (CID 118242697) is N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine.
What is the SMILES notation for N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine?
The canonical SMILES for N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine is CO[C@H]1CCCC[C@@H]1Oc1cc(F)ccc1NO.
What is the InChIKey of N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine?
The InChIKey is QMWDDKCJNJYMGD-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H18FNO3/c1-17-11-4-2-3-5-12(11)18-13-8-9(14)6-7-10(13)15-16/h6-8,11-12,15-16H,2-5H2,1H3/t11-,12-/m0/s1.
What are the key properties of N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine?
N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine has a molecular weight of 255.29 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-fluoro-2-[(1S,2S)-2-methoxycyclohexyl]oxyphenyl]hydroxylamine is sourced from PubChem (CID 118242697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).