About tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate
tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate (PubChem CID 176681811) has the molecular formula C17H24F2N2O2
and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate |
| PubChem CID | 176681811 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCNC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H24F2N2O2/c1-17(2,3)23-16(22)21(4)12-7-8-20-15(10-12)11-5-6-13(18)14(19)9-11/h5-6,9,12,15,20H,7-8,10H2,1-4H3 |
| InChIKey | UFIQRCCZGRRIKF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate (CID 176681811) is tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate is CN(C(=O)OC(C)(C)C)C1CCNC(c2ccc(F)c(F)c2)C1.
What is the InChIKey of tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate?
The InChIKey is UFIQRCCZGRRIKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O2/c1-17(2,3)23-16(22)21(4)12-7-8-20-15(10-12)11-5-6-13(18)14(19)9-11/h5-6,9,12,15,20H,7-8,10H2,1-4H3.
What are the key properties of tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate?
tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate has a molecular weight of 326.39 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(3,4-difluorophenyl)piperidin-4-yl]-N-methylcarbamate is sourced from PubChem (CID 176681811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).