C22H29BrN2O2 — CID 67268375
propyl N-[2-bromo-4-[(4-tert-butylphenyl)methyl-methylamino]phenyl]carbamate (PubChem CID 67268375) has the molecular formula C22H29BrN2O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is propyl N-[2-bromo-4-[(4-tert-butylphenyl)methyl-methylamino]phenyl]carbamate.
| Compound Name | propyl N-[2-bromo-4-[(4-tert-butylphenyl)methyl-methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 67268375 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | propyl N-[2-bromo-4-[(4-tert-butylphenyl)methyl-methylamino]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc(N(C)Cc2ccc(C(C)(C)C)cc2)cc1Br |
| InChI | InChI=1S/C22H29BrN2O2/c1-6-13-27-21(26)24-20-12-11-18(14-19(20)23)25(5)15-16-7-9-17(10-8-16)22(2,3)4/h7-12,14H,6,13,15H2,1-5H3,(H,24,26) |
| InChIKey | YLYPVBMLXLRFPR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |