C24H28FN3O4 — CID 155560988
propyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(propoxycarbonylamino)phenyl]carbamate (PubChem CID 155560988) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is propyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(propoxycarbonylamino)phenyl]carbamate.
| Compound Name | propyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(propoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 155560988 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | propyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(propoxycarbonylamino)phenyl]carbamate |
| SMILES | C#CCN(Cc1ccc(F)cc1)c1ccc(NC(=O)OCCC)c(NC(=O)OCCC)c1 |
| InChI | InChI=1S/C24H28FN3O4/c1-4-13-28(17-18-7-9-19(25)10-8-18)20-11-12-21(26-23(29)31-14-5-2)22(16-20)27-24(30)32-15-6-3/h1,7-12,16H,5-6,13-15,17H2,2-3H3,(H,26,29)(H,27,30) |
| InChIKey | MQVFJCQAXLHYPM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|