C24H24F3NO — CID 158932013
1-(4,4-difluorocyclohexyl)-2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]ethanone (PubChem CID 158932013) has the molecular formula C24H24F3NO and a molecular weight of 399.46 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]ethanone.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]ethanone |
|---|---|
| PubChem CID | 158932013 |
| Molecular Formula | C24H24F3NO |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]ethanone |
| SMILES | C#CCN(Cc1ccc(F)cc1)c1ccc(CC(=O)C2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C24H24F3NO/c1-2-15-28(17-19-3-7-21(25)8-4-19)22-9-5-18(6-10-22)16-23(29)20-11-13-24(26,27)14-12-20/h1,3-10,20H,11-17H2 |
| InChIKey | KRZWUHMMADEUTN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|