C20H20FN3O4 — CID 71558371
methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(methoxycarbonylamino)phenyl]carbamate (PubChem CID 71558371) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(methoxycarbonylamino)phenyl]carbamate.
| Compound Name | methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(methoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 71558371 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | methyl N-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]-2-(methoxycarbonylamino)phenyl]carbamate |
| SMILES | C#CCN(Cc1ccc(F)cc1)c1ccc(NC(=O)OC)c(NC(=O)OC)c1 |
| InChI | InChI=1S/C20H20FN3O4/c1-4-11-24(13-14-5-7-15(21)8-6-14)16-9-10-17(22-19(25)27-2)18(12-16)23-20(26)28-3/h1,5-10,12H,11,13H2,2-3H3,(H,22,25)(H,23,26) |
| InChIKey | QXLYUSKTAYZSGM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|