C19H18FNO2 — CID 157257178
methyl 2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]acetate (PubChem CID 157257178) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]acetate.
| Compound Name | methyl 2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]acetate |
|---|---|
| PubChem CID | 157257178 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 2-[4-[(4-fluorophenyl)methyl-prop-2-ynylamino]phenyl]acetate |
| SMILES | C#CCN(Cc1ccc(F)cc1)c1ccc(CC(=O)OC)cc1 |
| InChI | InChI=1S/C19H18FNO2/c1-3-12-21(14-16-4-8-17(20)9-5-16)18-10-6-15(7-11-18)13-19(22)23-2/h1,4-11H,12-14H2,2H3 |
| InChIKey | BAHQQWYQHHQUFI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|