C19H20BrF3N2O2 — CID 67267168
propyl N-[2-bromo-4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]carbamate (PubChem CID 67267168) has the molecular formula C19H20BrF3N2O2 and a molecular weight of 445.28 g/mol. Its IUPAC name is propyl N-[2-bromo-4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]carbamate.
| Compound Name | propyl N-[2-bromo-4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 67267168 |
| Molecular Formula | C19H20BrF3N2O2 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | propyl N-[2-bromo-4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc(N(C)Cc2ccc(C(F)(F)F)cc2)cc1Br |
| InChI | InChI=1S/C19H20BrF3N2O2/c1-3-10-27-18(26)24-17-9-8-15(11-16(17)20)25(2)12-13-4-6-14(7-5-13)19(21,22)23/h4-9,11H,3,10,12H2,1-2H3,(H,24,26) |
| InChIKey | TXNONQHAXVVONT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |