C10H13BrN2O3 — CID 115180249
3-amino-N-(5-bromo-2-methoxyphenyl)-2-hydroxypropanamide (PubChem CID 115180249) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 3-amino-N-(5-bromo-2-methoxyphenyl)-2-hydroxypropanamide.
| Compound Name | 3-amino-N-(5-bromo-2-methoxyphenyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 115180249 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 3-amino-N-(5-bromo-2-methoxyphenyl)-2-hydroxypropanamide |
| SMILES | COc1ccc(Br)cc1NC(=O)C(O)CN |
| InChI | InChI=1S/C10H13BrN2O3/c1-16-9-3-2-6(11)4-7(9)13-10(15)8(14)5-12/h2-4,8,14H,5,12H2,1H3,(H,13,15) |
| InChIKey | BGBGJDFZIUBZBQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |