C17H18F2N2O — CID 112984906
N-[4-(tert-butylamino)phenyl]-3,4-difluorobenzamide (PubChem CID 112984906) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is N-[4-(tert-butylamino)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(tert-butylamino)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 112984906 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[4-(tert-butylamino)phenyl]-3,4-difluorobenzamide |
| SMILES | CC(C)(C)Nc1ccc(NC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H18F2N2O/c1-17(2,3)21-13-7-5-12(6-8-13)20-16(22)11-4-9-14(18)15(19)10-11/h4-10,21H,1-3H3,(H,20,22) |
| InChIKey | PUANJBZARHBNIV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |