C26H24N2O4 — CID 130284062
N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 130284062) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 130284062 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)c3ccc4c(c3)C(=O)NC4=O)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-4-26(2,3)17-6-10-19(11-7-17)32-20-12-8-18(9-13-20)27-23(29)16-5-14-21-22(15-16)25(31)28-24(21)30/h5-15H,4H2,1-3H3,(H,27,29)(H,28,30,31) |
| InChIKey | AYFQBTRPSTWQFT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|