C29H17N5O7 — CID 167011128
N-[4-[[5-[(1,3-dioxoisoindole-5-carbonyl)amino]furan-2-yl]methylideneamino]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 167011128) has the molecular formula C29H17N5O7 and a molecular weight of 547.48 g/mol. Its IUPAC name is N-[4-[[5-[(1,3-dioxoisoindole-5-carbonyl)amino]furan-2-yl]methylideneamino]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[[5-[(1,3-dioxoisoindole-5-carbonyl)amino]furan-2-yl]methylideneamino]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 167011128 |
| Molecular Formula | C29H17N5O7 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | N-[4-[[5-[(1,3-dioxoisoindole-5-carbonyl)amino]furan-2-yl]methylideneamino]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(/N=C/c2ccc(NC(=O)c3ccc4c(c3)C(=O)NC4=O)o2)cc1)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C29H17N5O7/c35-24(14-1-8-19-21(11-14)28(39)33-26(19)37)31-17-5-3-16(4-6-17)30-13-18-7-10-23(41-18)32-25(36)15-2-9-20-22(12-15)29(40)34-27(20)38/h1-13H,(H,31,35)(H,32,36)(H,33,37,39)(H,34,38,40)/b30-13+ |
| InChIKey | AVLWOVOQWRTVIT-VVEOGCPPSA-N |
| XLogP | 3.30 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|