C17H16F2N2O2 — CID 56825610
N-[2-(4-acetamidophenyl)ethyl]-3,4-difluorobenzamide (PubChem CID 56825610) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[2-(4-acetamidophenyl)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(4-acetamidophenyl)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 56825610 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-(4-acetamidophenyl)ethyl]-3,4-difluorobenzamide |
| SMILES | CC(=O)Nc1ccc(CCNC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2N2O2/c1-11(22)21-14-5-2-12(3-6-14)8-9-20-17(23)13-4-7-15(18)16(19)10-13/h2-7,10H,8-9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | POWWOHVHXLRTHH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |