C22H14N4O3 — CID 108788490
N-(1,3-dioxoisoindol-5-yl)-2-phenylimidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 108788490) has the molecular formula C22H14N4O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-2-phenylimidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-2-phenylimidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 108788490 |
| Molecular Formula | C22H14N4O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-2-phenylimidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1ccn2cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H14N4O3/c27-20(23-15-6-7-16-17(11-15)22(29)25-21(16)28)14-8-9-26-12-18(24-19(26)10-14)13-4-2-1-3-5-13/h1-12H,(H,23,27)(H,25,28,29) |
| InChIKey | UXBAPILVXPNODE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|